C24H30N2O6 — CID 39970249
N-[(4-butoxy-3-methoxyphenyl)methyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 39970249) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39970249 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2cc3c(OC)cc(OC)c(OC)c3[nH]2)cc1OC |
| InChI | InChI=1S/C24H30N2O6/c1-6-7-10-32-18-9-8-15(11-20(18)29-3)14-25-24(27)17-12-16-19(28-2)13-21(30-4)23(31-5)22(16)26-17/h8-9,11-13,26H,6-7,10,14H2,1-5H3,(H,25,27) |
| InChIKey | QIRRCZRCFCIYAS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|