C22H29NO5 — CID 39971219
N-[(4-butoxy-3-methoxyphenyl)methyl]-2-(2,4-dimethoxyphenyl)acetamide (PubChem CID 39971219) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[(4-butoxy-3-methoxyphenyl)methyl]-2-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39971219 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | N-[(4-butoxy-3-methoxyphenyl)methyl]-2-(2,4-dimethoxyphenyl)acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)Cc2ccc(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C22H29NO5/c1-5-6-11-28-19-10-7-16(12-21(19)27-4)15-23-22(24)13-17-8-9-18(25-2)14-20(17)26-3/h7-10,12,14H,5-6,11,13,15H2,1-4H3,(H,23,24) |
| InChIKey | GRTPETCQKZRLTJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|