C17H18FNO3 — CID 27256771
2-(2,4-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 27256771) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 27256771 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H18FNO3/c1-21-15-8-5-13(16(10-15)22-2)9-17(20)19-11-12-3-6-14(18)7-4-12/h3-8,10H,9,11H2,1-2H3,(H,19,20) |
| InChIKey | VBEZLCXRSZQBCN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |