C17H17BrFNO3 — CID 9192585
2-(2-bromo-4,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 9192585) has the molecular formula C17H17BrFNO3 and a molecular weight of 382.23 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9192585 |
| Molecular Formula | C17H17BrFNO3 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | COc1cc(Br)c(CC(=O)NCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C17H17BrFNO3/c1-22-15-7-12(14(18)9-16(15)23-2)8-17(21)20-10-11-3-5-13(19)6-4-11/h3-7,9H,8,10H2,1-2H3,(H,20,21) |
| InChIKey | SGOLDAVTVNBVOZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |