C24H29N3O6 — CID 55968926
N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 55968926) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55968926 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[3-(3-ethoxypropylcarbamoyl)phenyl]-4,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)c2cc3c(OC)cc(OC)c(OC)c3[nH]2)c1 |
| InChI | InChI=1S/C24H29N3O6/c1-5-33-11-7-10-25-23(28)15-8-6-9-16(12-15)26-24(29)18-13-17-19(30-2)14-20(31-3)22(32-4)21(17)27-18/h6,8-9,12-14,27H,5,7,10-11H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | AMEKUFSAPXREEG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|