C19H28N2O5 — CID 39900401
N-(3-butoxypropyl)-4,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 39900401) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is N-(3-butoxypropyl)-4,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(3-butoxypropyl)-4,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 39900401 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-(3-butoxypropyl)-4,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1cc2c(OC)cc(OC)c(OC)c2[nH]1 |
| InChI | InChI=1S/C19H28N2O5/c1-5-6-9-26-10-7-8-20-19(22)14-11-13-15(23-2)12-16(24-3)18(25-4)17(13)21-14/h11-12,21H,5-10H2,1-4H3,(H,20,22) |
| InChIKey | OCBUHWWDWQNWGM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|