C17H25N3O4 — CID 4911389
N-[3-(dimethylamino)propyl]-4,5,6-trimethoxy-1H-indole-2-carboxamide (PubChem CID 4911389) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4,5,6-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 4911389 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2[nH]c(C(=O)NCCCN(C)C)cc2c(OC)c1OC |
| InChI | InChI=1S/C17H25N3O4/c1-20(2)8-6-7-18-17(21)13-9-11-12(19-13)10-14(22-3)16(24-5)15(11)23-4/h9-10,19H,6-8H2,1-5H3,(H,18,21) |
| InChIKey | WOYMHXREQQDBRQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|