C21H23N3O5 — CID 6878850
N-[(E)-(4-ethoxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide (PubChem CID 6878850) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[(E)-(4-ethoxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 6878850 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2cc3c(OC)c(OC)c(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-5-29-14-8-6-13(7-9-14)12-22-24-21(25)17-10-15-16(23-17)11-18(26-2)20(28-4)19(15)27-3/h6-12,23H,5H2,1-4H3,(H,24,25)/b22-12+ |
| InChIKey | JYODBTHGCWEJDW-WSDLNYQXSA-N |
| XLogP | 3.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|