C19H19N3O5 — CID 135651324
N-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide (PubChem CID 135651324) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135651324 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5,6-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2[nH]c(C(=O)N/N=C/c3ccccc3O)cc2c(OC)c1OC |
| InChI | InChI=1S/C19H19N3O5/c1-25-16-9-13-12(17(26-2)18(16)27-3)8-14(21-13)19(24)22-20-10-11-6-4-5-7-15(11)23/h4-10,21,23H,1-3H3,(H,22,24)/b20-10+ |
| InChIKey | MYDNWELMEUKHAH-KEBDBYFISA-N |
| XLogP | 2.66 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|