C18H17N3O5 — CID 2026239
N-[(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethoxy-1H-indole-2-carboxamide (PubChem CID 2026239) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 2026239 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-4,5-dimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NN=Cc3ccc(O)cc3O)cc2c1OC |
| InChI | InChI=1S/C18H17N3O5/c1-25-16-6-5-13-12(17(16)26-2)8-14(20-13)18(24)21-19-9-10-3-4-11(22)7-15(10)23/h3-9,20,22-23H,1-2H3,(H,21,24) |
| InChIKey | SZROZYKMIYUXTP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|