C20H21N3O5 — CID 6879756
N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4,7-dimethoxy-1H-indole-2-carboxamide (PubChem CID 6879756) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4,7-dimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4,7-dimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 6879756 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4,7-dimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc(OC)c(/C=N/NC(=O)c2cc3c(OC)ccc(OC)c3[nH]2)c1 |
| InChI | InChI=1S/C20H21N3O5/c1-25-13-5-6-16(26-2)12(9-13)11-21-23-20(24)15-10-14-17(27-3)7-8-18(28-4)19(14)22-15/h5-11,22H,1-4H3,(H,23,24)/b21-11+ |
| InChIKey | ZLLVPIWEOVGPNA-SRZZPIQSSA-N |
| XLogP | 2.97 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|