C16H13N3O3 — CID 137014970
N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-1H-indole-2-carboxamide (PubChem CID 137014970) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-1H-indole-2-carboxamide.
| Compound Name | N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 137014970 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(O)c1O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H13N3O3/c20-14-7-3-5-11(15(14)21)9-17-19-16(22)13-8-10-4-1-2-6-12(10)18-13/h1-9,18,20-21H,(H,19,22)/b17-9+ |
| InChIKey | GKFJIOWZSUMZDZ-RQZCQDPDSA-N |
| XLogP | 2.34 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|