C16H14N4O6 — CID 5041852
N,N'-bis[(2,3-dihydroxyphenyl)methylideneamino]oxamide (PubChem CID 5041852) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is N,N'-bis[(2,3-dihydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N,N'-bis[(2,3-dihydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 5041852 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N,N'-bis[(2,3-dihydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1cccc(O)c1O)C(=O)NN=Cc1cccc(O)c1O |
| InChI | InChI=1S/C16H14N4O6/c21-11-5-1-3-9(13(11)23)7-17-19-15(25)16(26)20-18-8-10-4-2-6-12(22)14(10)24/h1-8,21-24H,(H,19,25)(H,20,26) |
| InChIKey | DYQXVZSFENWRFS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|