C10H13N3O4 — CID 137255353
2-amino-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-hydroxypropanamide (PubChem CID 137255353) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-amino-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-hydroxypropanamide.
| Compound Name | 2-amino-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 137255353 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-amino-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-3-hydroxypropanamide |
| SMILES | NC(CO)C(=O)N/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C10H13N3O4/c11-7(5-14)10(17)13-12-4-6-2-1-3-8(15)9(6)16/h1-4,7,14-16H,5,11H2,(H,13,17)/b12-4+ |
| InChIKey | MGOQKPKDGQYJGQ-UUILKARUSA-N |
| XLogP | -1.13 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|