C12H17N3O5 — CID 166986656
(2S)-2-amino-3-hydroxy-N-[(E)-(3-hydroxy-2,4-dimethoxyphenyl)methylideneamino]propanamide (PubChem CID 166986656) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-N-[(E)-(3-hydroxy-2,4-dimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-amino-3-hydroxy-N-[(E)-(3-hydroxy-2,4-dimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 166986656 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-N-[(E)-(3-hydroxy-2,4-dimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(/C=N/NC(=O)[C@@H](N)CO)c(OC)c1O |
| InChI | InChI=1S/C12H17N3O5/c1-19-9-4-3-7(11(20-2)10(9)17)5-14-15-12(18)8(13)6-16/h3-5,8,16-17H,6,13H2,1-2H3,(H,15,18)/b14-5+/t8-/m0/s1 |
| InChIKey | WSDUZGMCSRBAAB-SKUMYXODSA-N |
| XLogP | -0.82 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|