C18H21N3O4 — CID 135493662
2-amino-N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 135493662) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-amino-N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 2-amino-N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 135493662 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-amino-N-[(E)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CCOc1cccc(/C=N/NC(=O)C(N)Cc2ccc(O)cc2)c1O |
| InChI | InChI=1S/C18H21N3O4/c1-2-25-16-5-3-4-13(17(16)23)11-20-21-18(24)15(19)10-12-6-8-14(22)9-7-12/h3-9,11,15,22-23H,2,10,19H2,1H3,(H,21,24)/b20-11+ |
| InChIKey | WCIVWAFEQRECEZ-RGVLZGJSSA-N |
| XLogP | 1.52 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|