C11H12N2O3 — CID 2693831
N-[(2,3-dihydroxyphenyl)methylideneamino]cyclopropanecarboxamide (PubChem CID 2693831) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(2,3-dihydroxyphenyl)methylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(2,3-dihydroxyphenyl)methylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 2693831 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(2,3-dihydroxyphenyl)methylideneamino]cyclopropanecarboxamide |
| SMILES | O=C(NN=Cc1cccc(O)c1O)C1CC1 |
| InChI | InChI=1S/C11H12N2O3/c14-9-3-1-2-8(10(9)15)6-12-13-11(16)7-4-5-7/h1-3,6-7,14-15H,4-5H2,(H,13,16) |
| InChIKey | LYBHMWGZGKBEIW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|