C22H30N4O4 — CID 102168751
2-N,7-N-dibutyl-4,5-dimethoxy-1,8-dihydropyrrolo[3,2-g]indole-2,7-dicarboxamide (PubChem CID 102168751) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-N,7-N-dibutyl-4,5-dimethoxy-1,8-dihydropyrrolo[3,2-g]indole-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-dibutyl-4,5-dimethoxy-1,8-dihydropyrrolo[3,2-g]indole-2,7-dicarboxamide |
|---|---|
| PubChem CID | 102168751 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-N,7-N-dibutyl-4,5-dimethoxy-1,8-dihydropyrrolo[3,2-g]indole-2,7-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc2c(OC)c(OC)c3cc(C(=O)NCCCC)[nH]c3c2[nH]1 |
| InChI | InChI=1S/C22H30N4O4/c1-5-7-9-23-21(27)15-11-13-17(25-15)18-14(20(30-4)19(13)29-3)12-16(26-18)22(28)24-10-8-6-2/h11-12,25-26H,5-10H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | JVBAWEVSRPYQKE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|