C12H15I2NO2 — CID 24834302
N-butyl-3,5-diiodo-4-methoxybenzamide (PubChem CID 24834302) has the molecular formula C12H15I2NO2 and a molecular weight of 459.07 g/mol. Its IUPAC name is N-butyl-3,5-diiodo-4-methoxybenzamide.
| Compound Name | N-butyl-3,5-diiodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 24834302 |
| Molecular Formula | C12H15I2NO2 |
| Molecular Weight | 459.07 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | N-butyl-3,5-diiodo-4-methoxybenzamide |
| SMILES | CCCCNC(=O)c1cc(I)c(OC)c(I)c1 |
| InChI | InChI=1S/C12H15I2NO2/c1-3-4-5-15-12(16)8-6-9(13)11(17-2)10(14)7-8/h6-7H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | WASKHBDMPAOTQG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|