C12H14F3NO2 — CID 91730406
N-butyl-2,4,5-trifluoro-3-methoxybenzamide (PubChem CID 91730406) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-butyl-2,4,5-trifluoro-3-methoxybenzamide.
| Compound Name | N-butyl-2,4,5-trifluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 91730406 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-butyl-2,4,5-trifluoro-3-methoxybenzamide |
| SMILES | CCCCNC(=O)c1cc(F)c(F)c(OC)c1F |
| InChI | InChI=1S/C12H14F3NO2/c1-3-4-5-16-12(17)7-6-8(13)10(15)11(18-2)9(7)14/h6H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | XQTBTPRQVOQMRP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|