C22H21F6NO4 — CID 91730464
2,4,5-trifluoro-N-hexyl-3-methoxy-N-(2,4,5-trifluoro-3-methoxybenzoyl)benzamide (PubChem CID 91730464) has the molecular formula C22H21F6NO4 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-hexyl-3-methoxy-N-(2,4,5-trifluoro-3-methoxybenzoyl)benzamide.
| Compound Name | 2,4,5-trifluoro-N-hexyl-3-methoxy-N-(2,4,5-trifluoro-3-methoxybenzoyl)benzamide |
|---|---|
| PubChem CID | 91730464 |
| Molecular Formula | C22H21F6NO4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2,4,5-trifluoro-N-hexyl-3-methoxy-N-(2,4,5-trifluoro-3-methoxybenzoyl)benzamide |
| SMILES | CCCCCCN(C(=O)c1cc(F)c(F)c(OC)c1F)C(=O)c1cc(F)c(F)c(OC)c1F |
| InChI | InChI=1S/C22H21F6NO4/c1-4-5-6-7-8-29(21(30)11-9-13(23)17(27)19(32-2)15(11)25)22(31)12-10-14(24)18(28)20(33-3)16(12)26/h9-10H,4-8H2,1-3H3 |
| InChIKey | VGSOKFCQIRBMIH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|