C22H34F3NO — CID 533120
2,3,4-trifluoro-N-heptyl-N-octylbenzamide (PubChem CID 533120) has the molecular formula C22H34F3NO and a molecular weight of 385.51 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-heptyl-N-octylbenzamide.
| Compound Name | 2,3,4-trifluoro-N-heptyl-N-octylbenzamide |
|---|---|
| PubChem CID | 533120 |
| Molecular Formula | C22H34F3NO |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 2,3,4-trifluoro-N-heptyl-N-octylbenzamide |
| SMILES | CCCCCCCCN(CCCCCCC)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H34F3NO/c1-3-5-7-9-11-13-17-26(16-12-10-8-6-4-2)22(27)18-14-15-19(23)21(25)20(18)24/h14-15H,3-13,16-17H2,1-2H3 |
| InChIKey | VBCAAZFACPGFQX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|