C18H26F3NO — CID 91723493
N-butyl-2,3,4-trifluoro-N-heptan-2-ylbenzamide (PubChem CID 91723493) has the molecular formula C18H26F3NO and a molecular weight of 329.41 g/mol. Its IUPAC name is N-butyl-2,3,4-trifluoro-N-heptan-2-ylbenzamide.
| Compound Name | N-butyl-2,3,4-trifluoro-N-heptan-2-ylbenzamide |
|---|---|
| PubChem CID | 91723493 |
| Molecular Formula | C18H26F3NO |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-butyl-2,3,4-trifluoro-N-heptan-2-ylbenzamide |
| SMILES | CCCCCC(C)N(CCCC)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H26F3NO/c1-4-6-8-9-13(3)22(12-7-5-2)18(23)14-10-11-15(19)17(21)16(14)20/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | QYJHFDPCFTUVNM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|