C11H9F3N2O — CID 79017496
N-(cyanomethyl)-N-ethyl-2,3,4-trifluorobenzamide (PubChem CID 79017496) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is N-(cyanomethyl)-N-ethyl-2,3,4-trifluorobenzamide.
| Compound Name | N-(cyanomethyl)-N-ethyl-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 79017496 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-(cyanomethyl)-N-ethyl-2,3,4-trifluorobenzamide |
| SMILES | CCN(CC#N)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F3N2O/c1-2-16(6-5-15)11(17)7-3-4-8(12)10(14)9(7)13/h3-4H,2,6H2,1H3 |
| InChIKey | UDFYFJGDCPVKKA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|