C10H7F3N2O — CID 79017323
N-(cyanomethyl)-2,3,4-trifluoro-N-methylbenzamide (PubChem CID 79017323) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is N-(cyanomethyl)-2,3,4-trifluoro-N-methylbenzamide.
| Compound Name | N-(cyanomethyl)-2,3,4-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 79017323 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N-(cyanomethyl)-2,3,4-trifluoro-N-methylbenzamide |
| SMILES | CN(CC#N)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H7F3N2O/c1-15(5-4-14)10(16)6-2-3-7(11)9(13)8(6)12/h2-3H,5H2,1H3 |
| InChIKey | LGABCIYNIICHEZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|