C10H9F3N2O2 — CID 82086017
N-(2-amino-2-oxoethyl)-2,3,4-trifluoro-N-methylbenzamide (PubChem CID 82086017) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,3,4-trifluoro-N-methylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,3,4-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 82086017 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,3,4-trifluoro-N-methylbenzamide |
| SMILES | CN(CC(N)=O)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H9F3N2O2/c1-15(4-7(14)16)10(17)5-2-3-6(11)9(13)8(5)12/h2-3H,4H2,1H3,(H2,14,16) |
| InChIKey | SCDXKHCNVXPZLX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|