C11H14N2O3 — CID 82829163
N-(2-amino-2-oxoethyl)-3-hydroxy-N,2-dimethylbenzamide (PubChem CID 82829163) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-hydroxy-N,2-dimethylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 82829163 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-hydroxy-N,2-dimethylbenzamide |
| SMILES | Cc1c(O)cccc1C(=O)N(C)CC(N)=O |
| InChI | InChI=1S/C11H14N2O3/c1-7-8(4-3-5-9(7)14)11(16)13(2)6-10(12)15/h3-5,14H,6H2,1-2H3,(H2,12,15) |
| InChIKey | GLQUIOHNZKOJAT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |