C11H13FN2O2 — CID 80718993
N-(2-amino-2-oxoethyl)-2-fluoro-N,3-dimethylbenzamide (PubChem CID 80718993) has the molecular formula C11H13FN2O2 and a molecular weight of 224.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-fluoro-N,3-dimethylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-fluoro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 80718993 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-fluoro-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CC(N)=O)c1F |
| InChI | InChI=1S/C11H13FN2O2/c1-7-4-3-5-8(10(7)12)11(16)14(2)6-9(13)15/h3-5H,6H2,1-2H3,(H2,13,15) |
| InChIKey | YLZUWHZTKFTUAF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |