C12H11F3O — CID 103447577
(Z)-2-ethyl-1-(2,3,4-trifluorophenyl)but-2-en-1-one (PubChem CID 103447577) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is (Z)-2-ethyl-1-(2,3,4-trifluorophenyl)but-2-en-1-one.
| Compound Name | (Z)-2-ethyl-1-(2,3,4-trifluorophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 103447577 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (Z)-2-ethyl-1-(2,3,4-trifluorophenyl)but-2-en-1-one |
| SMILES | C/C=C(/CC)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H11F3O/c1-3-7(4-2)12(16)8-5-6-9(13)11(15)10(8)14/h3,5-6H,4H2,1-2H3/b7-3- |
| InChIKey | RTBQANHFDYKCLL-CLTKARDFSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|