C9H3F3O — CID 114978534
1-(2,3,4-trifluorophenyl)prop-2-yn-1-one (PubChem CID 114978534) has the molecular formula C9H3F3O and a molecular weight of 184.12 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)prop-2-yn-1-one.
| Compound Name | 1-(2,3,4-trifluorophenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 114978534 |
| Molecular Formula | C9H3F3O |
| Molecular Weight | 184.12 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)prop-2-yn-1-one |
| SMILES | C#CC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H3F3O/c1-2-7(13)5-3-4-6(10)9(12)8(5)11/h1,3-4H |
| InChIKey | WQBFMTNDWKNITK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|