C11H8F3NO — CID 116606703
2-amino-1-(2,3,4-trifluorophenyl)pent-4-yn-1-one (PubChem CID 116606703) has the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-amino-1-(2,3,4-trifluorophenyl)pent-4-yn-1-one.
| Compound Name | 2-amino-1-(2,3,4-trifluorophenyl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 116606703 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-amino-1-(2,3,4-trifluorophenyl)pent-4-yn-1-one |
| SMILES | C#CCC(N)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H8F3NO/c1-2-3-8(15)11(16)6-4-5-7(12)10(14)9(6)13/h1,4-5,8H,3,15H2 |
| InChIKey | LBTVXKMDMQZGEC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|