C12H12F3NO — CID 116608854
3-amino-3-cyclopropyl-1-(2,3,4-trifluorophenyl)propan-1-one (PubChem CID 116608854) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 3-amino-3-cyclopropyl-1-(2,3,4-trifluorophenyl)propan-1-one.
| Compound Name | 3-amino-3-cyclopropyl-1-(2,3,4-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 116608854 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-amino-3-cyclopropyl-1-(2,3,4-trifluorophenyl)propan-1-one |
| SMILES | NC(CC(=O)c1ccc(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C12H12F3NO/c13-8-4-3-7(11(14)12(8)15)10(17)5-9(16)6-1-2-6/h3-4,6,9H,1-2,5,16H2 |
| InChIKey | QCUKYLOOJIKKDX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|