C11H9F3O3 — CID 103543680
2-(1,3-dioxolan-2-yl)-1-(2,3,4-trifluorophenyl)ethanone (PubChem CID 103543680) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(2,3,4-trifluorophenyl)ethanone.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(2,3,4-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 103543680 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(2,3,4-trifluorophenyl)ethanone |
| SMILES | O=C(CC1OCCO1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F3O3/c12-7-2-1-6(10(13)11(7)14)8(15)5-9-16-3-4-17-9/h1-2,9H,3-5H2 |
| InChIKey | TYMGGVIKYWUIAC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|