C11H9BrF2O3 — CID 106944374
1-(3-bromo-2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone (PubChem CID 106944374) has the molecular formula C11H9BrF2O3 and a molecular weight of 307.09 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 106944374 |
| Molecular Formula | C11H9BrF2O3 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-(1,3-dioxolan-2-yl)ethanone |
| SMILES | O=C(CC1OCCO1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H9BrF2O3/c12-6-1-2-7(13)10(11(6)14)8(15)5-9-16-3-4-17-9/h1-2,9H,3-5H2 |
| InChIKey | FBKVCBXGQMBQCP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|