C13H7BrF2O — CID 106941652
(3-bromo-2,6-difluorophenyl)-phenylmethanone (PubChem CID 106941652) has the molecular formula C13H7BrF2O and a molecular weight of 297.10 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-phenylmethanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 106941652 |
| Molecular Formula | C13H7BrF2O |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H7BrF2O/c14-9-6-7-10(15)11(12(9)16)13(17)8-4-2-1-3-5-8/h1-7H |
| InChIKey | WUPXLYZHHVJRLJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|