C7H2BrClF2O — CID 51000132
3-bromo-2,6-difluorobenzoyl chloride (PubChem CID 51000132) has the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. Its IUPAC name is 3-bromo-2,6-difluorobenzoyl chloride.
| Compound Name | 3-bromo-2,6-difluorobenzoyl chloride |
|---|---|
| PubChem CID | 51000132 |
| Molecular Formula | C7H2BrClF2O |
| Molecular Weight | 255.44 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 3-bromo-2,6-difluorobenzoyl chloride |
| SMILES | O=C(Cl)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C7H2BrClF2O/c8-3-1-2-4(10)5(6(3)11)7(9)12/h1-2H |
| InChIKey | OYEKTFNTUYRFBD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|