About 3-bromo-6-fluorophthalic acid
3-bromo-6-fluorophthalic acid (PubChem CID 164890532) has the molecular formula C8H4BrFO4
and a molecular weight of 263.02 g/mol. Its IUPAC name is 3-bromo-6-fluorophthalic acid.
Molecular Properties
| Compound Name | 3-bromo-6-fluorophthalic acid |
| PubChem CID | 164890532 |
| Molecular Formula | C8H4BrFO4 |
| Molecular Weight | 263.02 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | 3-bromo-6-fluorophthalic acid |
| SMILES | O=C(O)c1c(F)ccc(Br)c1C(=O)O |
| InChI | InChI=1S/C8H4BrFO4/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2H,(H,11,12)(H,13,14) |
| InChIKey | JULNWWMTYKENJR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.02 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-6-fluorophthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-fluorophthalic acid?
The IUPAC name of 3-bromo-6-fluorophthalic acid (CID 164890532) is 3-bromo-6-fluorophthalic acid.
What is the SMILES notation for 3-bromo-6-fluorophthalic acid?
The canonical SMILES for 3-bromo-6-fluorophthalic acid is O=C(O)c1c(F)ccc(Br)c1C(=O)O.
What is the InChIKey of 3-bromo-6-fluorophthalic acid?
The InChIKey is JULNWWMTYKENJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrFO4/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2H,(H,11,12)(H,13,14).
What are the key properties of 3-bromo-6-fluorophthalic acid?
3-bromo-6-fluorophthalic acid has a molecular weight of 263.02 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-fluorophthalic acid is sourced from PubChem (CID 164890532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).