2-(aminomethyl)-3,6-difluorobenzoic acid

C8H7F2NO2 — CID 115017213

IUPAC2-(aminomethyl)-3,6-difluorobenzoic acid
SMILESNCc1c(F)ccc(F)c1C(=O)O
InChIInChI=1S/C8H7F2NO2/c9-5-1-2-6(10)7(8(12)13)4(5)3-11/h1-2H,3,11H2,(H,12,13)
InChIKeyFTJSOABDDVMYSM-UHFFFAOYSA-N
MW187.15 g/mol
LogP1.12
Rot. Bonds2

About 2-(aminomethyl)-3,6-difluorobenzoic acid

2-(aminomethyl)-3,6-difluorobenzoic acid (PubChem CID 115017213) has the molecular formula C8H7F2NO2 and a molecular weight of 187.15 g/mol. Its IUPAC name is 2-(aminomethyl)-3,6-difluorobenzoic acid.

Molecular Properties

Compound Name2-(aminomethyl)-3,6-difluorobenzoic acid
PubChem CID115017213
Molecular FormulaC8H7F2NO2
Molecular Weight187.15 g/mol
Exact Mass187.04
IUPAC Name2-(aminomethyl)-3,6-difluorobenzoic acid
SMILESNCc1c(F)ccc(F)c1C(=O)O
InChIInChI=1S/C8H7F2NO2/c9-5-1-2-6(10)7(8(12)13)4(5)3-11/h1-2H,3,11H2,(H,12,13)
InChIKeyFTJSOABDDVMYSM-UHFFFAOYSA-N
XLogP1.12
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.15
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(aminomethyl)-3,6-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)-3,6-difluorobenzoic acid?
The IUPAC name of 2-(aminomethyl)-3,6-difluorobenzoic acid (CID 115017213) is 2-(aminomethyl)-3,6-difluorobenzoic acid.
What is the SMILES notation for 2-(aminomethyl)-3,6-difluorobenzoic acid?
The canonical SMILES for 2-(aminomethyl)-3,6-difluorobenzoic acid is NCc1c(F)ccc(F)c1C(=O)O.
What is the InChIKey of 2-(aminomethyl)-3,6-difluorobenzoic acid?
The InChIKey is FTJSOABDDVMYSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO2/c9-5-1-2-6(10)7(8(12)13)4(5)3-11/h1-2H,3,11H2,(H,12,13).
What are the key properties of 2-(aminomethyl)-3,6-difluorobenzoic acid?
2-(aminomethyl)-3,6-difluorobenzoic acid has a molecular weight of 187.15 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,6-difluorobenzoic acid is sourced from PubChem (CID 115017213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).