C8H6FNO4 — CID 121254589
2-amino-4-fluorobenzene-1,3-dicarboxylic acid (PubChem CID 121254589) has the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. Its IUPAC name is 2-amino-4-fluorobenzene-1,3-dicarboxylic acid.
| Compound Name | 2-amino-4-fluorobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 121254589 |
| Molecular Formula | C8H6FNO4 |
| Molecular Weight | 199.14 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 2-amino-4-fluorobenzene-1,3-dicarboxylic acid |
| SMILES | Nc1c(C(=O)O)ccc(F)c1C(=O)O |
| InChI | InChI=1S/C8H6FNO4/c9-4-2-1-3(7(11)12)6(10)5(4)8(13)14/h1-2H,10H2,(H,11,12)(H,13,14) |
| InChIKey | ZRGYLSAPYWXTCG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|