C10H7ClF2O4S — CID 43323727
3-(2-chloroprop-2-enylsulfonyl)-2,6-difluorobenzoic acid (PubChem CID 43323727) has the molecular formula C10H7ClF2O4S and a molecular weight of 296.68 g/mol. Its IUPAC name is 3-(2-chloroprop-2-enylsulfonyl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(2-chloroprop-2-enylsulfonyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 43323727 |
| Molecular Formula | C10H7ClF2O4S |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 3-(2-chloroprop-2-enylsulfonyl)-2,6-difluorobenzoic acid |
| SMILES | C=C(Cl)CS(=O)(=O)c1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C10H7ClF2O4S/c1-5(11)4-18(16,17)7-3-2-6(12)8(9(7)13)10(14)15/h2-3H,1,4H2,(H,14,15) |
| InChIKey | MKESWRKVBQEEAH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |