C9H6F4O4S — CID 54939186
3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid (PubChem CID 54939186) has the molecular formula C9H6F4O4S and a molecular weight of 286.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 54939186 |
| Molecular Formula | C9H6F4O4S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid |
| SMILES | O=C(O)c1c(F)ccc(S(=O)(=O)CC(F)F)c1F |
| InChI | InChI=1S/C9H6F4O4S/c10-4-1-2-5(8(13)7(4)9(14)15)18(16,17)3-6(11)12/h1-2,6H,3H2,(H,14,15) |
| InChIKey | PIJIPAQSBVLSIW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |