3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid

C9H6F4O4S — CID 54939186

IUPAC3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid
SMILESO=C(O)c1c(F)ccc(S(=O)(=O)CC(F)F)c1F
InChIInChI=1S/C9H6F4O4S/c10-4-1-2-5(8(13)7(4)9(14)15)18(16,17)3-6(11)12/h1-2,6H,3H2,(H,14,15)
InChIKeyPIJIPAQSBVLSIW-UHFFFAOYSA-N
MW286.20 g/mol
LogP1.70
Rot. Bonds4

About 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid

3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid (PubChem CID 54939186) has the molecular formula C9H6F4O4S and a molecular weight of 286.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid.

Molecular Properties

Compound Name3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid
PubChem CID54939186
Molecular FormulaC9H6F4O4S
Molecular Weight286.20 g/mol
Exact Mass285.99
IUPAC Name3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid
SMILESO=C(O)c1c(F)ccc(S(=O)(=O)CC(F)F)c1F
InChIInChI=1S/C9H6F4O4S/c10-4-1-2-5(8(13)7(4)9(14)15)18(16,17)3-6(11)12/h1-2,6H,3H2,(H,14,15)
InChIKeyPIJIPAQSBVLSIW-UHFFFAOYSA-N
XLogP1.70
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.20
LogP ≤ 51.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid?
The IUPAC name of 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid (CID 54939186) is 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid.
What is the SMILES notation for 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid?
The canonical SMILES for 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid is O=C(O)c1c(F)ccc(S(=O)(=O)CC(F)F)c1F.
What is the InChIKey of 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid?
The InChIKey is PIJIPAQSBVLSIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F4O4S/c10-4-1-2-5(8(13)7(4)9(14)15)18(16,17)3-6(11)12/h1-2,6H,3H2,(H,14,15).
What are the key properties of 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid?
3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid has a molecular weight of 286.20 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethylsulfonyl)-2,6-difluorobenzoic acid is sourced from PubChem (CID 54939186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).