About 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid
3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid (PubChem CID 82851072) has the molecular formula C10H10F2O6S
and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid |
| PubChem CID | 82851072 |
| Molecular Formula | C10H10F2O6S |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid |
| SMILES | O=C(O)c1c(F)ccc(S(=O)(=O)CC(O)CO)c1F |
| InChI | InChI=1S/C10H10F2O6S/c11-6-1-2-7(9(12)8(6)10(15)16)19(17,18)4-5(14)3-13/h1-2,5,13-14H,3-4H2,(H,15,16) |
| InChIKey | AFBYNMXINZQKTK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid?
The IUPAC name of 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid (CID 82851072) is 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid.
What is the SMILES notation for 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid?
The canonical SMILES for 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid is O=C(O)c1c(F)ccc(S(=O)(=O)CC(O)CO)c1F.
What is the InChIKey of 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid?
The InChIKey is AFBYNMXINZQKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O6S/c11-6-1-2-7(9(12)8(6)10(15)16)19(17,18)4-5(14)3-13/h1-2,5,13-14H,3-4H2,(H,15,16).
What are the key properties of 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid?
3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid has a molecular weight of 296.25 g/mol, XLogP of -0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropylsulfonyl)-2,6-difluorobenzoic acid is sourced from PubChem (CID 82851072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).