C11H12F2O5S — CID 113382849
2,6-difluoro-3-(2-methoxypropylsulfonyl)benzoic acid (PubChem CID 113382849) has the molecular formula C11H12F2O5S and a molecular weight of 294.28 g/mol. Its IUPAC name is 2,6-difluoro-3-(2-methoxypropylsulfonyl)benzoic acid.
| Compound Name | 2,6-difluoro-3-(2-methoxypropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 113382849 |
| Molecular Formula | C11H12F2O5S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2,6-difluoro-3-(2-methoxypropylsulfonyl)benzoic acid |
| SMILES | COC(C)CS(=O)(=O)c1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C11H12F2O5S/c1-6(18-2)5-19(16,17)8-4-3-7(12)9(10(8)13)11(14)15/h3-4,6H,5H2,1-2H3,(H,14,15) |
| InChIKey | GDKMKTGGHMCBLY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |