C11H14F2N2O4S — CID 61404116
2,6-difluoro-3-[3-(methylamino)propylsulfamoyl]benzoic acid (PubChem CID 61404116) has the molecular formula C11H14F2N2O4S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2,6-difluoro-3-[3-(methylamino)propylsulfamoyl]benzoic acid.
| Compound Name | 2,6-difluoro-3-[3-(methylamino)propylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 61404116 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2,6-difluoro-3-[3-(methylamino)propylsulfamoyl]benzoic acid |
| SMILES | CNCCCNS(=O)(=O)c1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C11H14F2N2O4S/c1-14-5-2-6-15-20(18,19)8-4-3-7(12)9(10(8)13)11(16)17/h3-4,14-15H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | QGDWEQYJUOPKJT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|