C7H6F2IN — CID 171014963
(3,6-difluoro-2-iodophenyl)methanamine (PubChem CID 171014963) has the molecular formula C7H6F2IN and a molecular weight of 269.03 g/mol. Its IUPAC name is (3,6-difluoro-2-iodophenyl)methanamine.
| Compound Name | (3,6-difluoro-2-iodophenyl)methanamine |
|---|---|
| PubChem CID | 171014963 |
| Molecular Formula | C7H6F2IN |
| Molecular Weight | 269.03 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | (3,6-difluoro-2-iodophenyl)methanamine |
| SMILES | NCc1c(F)ccc(F)c1I |
| InChI | InChI=1S/C7H6F2IN/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2H,3,11H2 |
| InChIKey | DQORHWJQDUPUOI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.03 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|