About 3-ethyl-1-fluoro-2,4-diiodobenzene
3-ethyl-1-fluoro-2,4-diiodobenzene (PubChem CID 118802109) has the molecular formula C8H7FI2
and a molecular weight of 375.95 g/mol. Its IUPAC name is 3-ethyl-1-fluoro-2,4-diiodobenzene.
Molecular Properties
| Compound Name | 3-ethyl-1-fluoro-2,4-diiodobenzene |
| PubChem CID | 118802109 |
| Molecular Formula | C8H7FI2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | 3-ethyl-1-fluoro-2,4-diiodobenzene |
| SMILES | CCc1c(I)ccc(F)c1I |
| InChI | InChI=1S/C8H7FI2/c1-2-5-7(10)4-3-6(9)8(5)11/h3-4H,2H2,1H3 |
| InChIKey | JCACGPUXRZCADS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-fluoro-2,4-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-fluoro-2,4-diiodobenzene?
The IUPAC name of 3-ethyl-1-fluoro-2,4-diiodobenzene (CID 118802109) is 3-ethyl-1-fluoro-2,4-diiodobenzene.
What is the SMILES notation for 3-ethyl-1-fluoro-2,4-diiodobenzene?
The canonical SMILES for 3-ethyl-1-fluoro-2,4-diiodobenzene is CCc1c(I)ccc(F)c1I.
What is the InChIKey of 3-ethyl-1-fluoro-2,4-diiodobenzene?
The InChIKey is JCACGPUXRZCADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FI2/c1-2-5-7(10)4-3-6(9)8(5)11/h3-4H,2H2,1H3.
What are the key properties of 3-ethyl-1-fluoro-2,4-diiodobenzene?
3-ethyl-1-fluoro-2,4-diiodobenzene has a molecular weight of 375.95 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-fluoro-2,4-diiodobenzene is sourced from PubChem (CID 118802109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).