C8H6F2N2 — CID 118991249
2-(aminomethyl)-3,6-difluorobenzonitrile (PubChem CID 118991249) has the molecular formula C8H6F2N2 and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(aminomethyl)-3,6-difluorobenzonitrile.
| Compound Name | 2-(aminomethyl)-3,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 118991249 |
| Molecular Formula | C8H6F2N2 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-(aminomethyl)-3,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)ccc(F)c1CN |
| InChI | InChI=1S/C8H6F2N2/c9-7-1-2-8(10)6(4-12)5(7)3-11/h1-2H,3,11H2 |
| InChIKey | VRDFGUFGPYJUAX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |