C7H3F2NO — CID 45083150
3,6-difluoro-2-hydroxybenzonitrile (PubChem CID 45083150) has the molecular formula C7H3F2NO and a molecular weight of 155.10 g/mol. Its IUPAC name is 3,6-difluoro-2-hydroxybenzonitrile.
| Compound Name | 3,6-difluoro-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 45083150 |
| Molecular Formula | C7H3F2NO |
| Molecular Weight | 155.10 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | 3,6-difluoro-2-hydroxybenzonitrile |
| SMILES | N#Cc1c(F)ccc(F)c1O |
| InChI | InChI=1S/C7H3F2NO/c8-5-1-2-6(9)7(11)4(5)3-10/h1-2,11H |
| InChIKey | SQASFBKKYDOFOK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |