C7H3ClFNO2 — CID 117280912
3-chloro-2-fluoro-5,6-dihydroxybenzonitrile (PubChem CID 117280912) has the molecular formula C7H3ClFNO2 and a molecular weight of 187.56 g/mol. Its IUPAC name is 3-chloro-2-fluoro-5,6-dihydroxybenzonitrile.
| Compound Name | 3-chloro-2-fluoro-5,6-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 117280912 |
| Molecular Formula | C7H3ClFNO2 |
| Molecular Weight | 187.56 g/mol |
| Exact Mass | 186.98 |
| IUPAC Name | 3-chloro-2-fluoro-5,6-dihydroxybenzonitrile |
| SMILES | N#Cc1c(O)c(O)cc(Cl)c1F |
| InChI | InChI=1S/C7H3ClFNO2/c8-4-1-5(11)7(12)3(2-10)6(4)9/h1,11-12H |
| InChIKey | QARKSLPRCJJOBE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|