C7HBrCl2FN — CID 169336315
2-bromo-3,5-dichloro-6-fluorobenzonitrile (PubChem CID 169336315) has the molecular formula C7HBrCl2FN and a molecular weight of 268.90 g/mol. Its IUPAC name is 2-bromo-3,5-dichloro-6-fluorobenzonitrile.
| Compound Name | 2-bromo-3,5-dichloro-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 169336315 |
| Molecular Formula | C7HBrCl2FN |
| Molecular Weight | 268.90 g/mol |
| Exact Mass | 266.87 |
| IUPAC Name | 2-bromo-3,5-dichloro-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)c(Cl)cc(Cl)c1Br |
| InChI | InChI=1S/C7HBrCl2FN/c8-6-3(2-12)7(11)5(10)1-4(6)9/h1H |
| InChIKey | UBRXHRHZRHTYNZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|